What happens when MgCO3 reacts with HNO3?
What happens when MgCO3 reacts with HNO3?
When magnesium carbonate, MgCO3, is treated with a dilute solution of nitric acid, HNO3, the products are magnesium nitrate, Mg(NO3)2, water and carbon dioxide gas. …
Will MgCO3 dissolve in HNO3?
[Note: Often used in an aqueous solution. Fuming nitric acid is concentrated nitric acid that contains dissolved nitrogen dioxide.]…
| 1 | HNO3 + MgCO3 → H2O + CO2 + Mg(NO3)2 |
|---|---|
| 2 | HNO3 + Mg(HCO3)2 → H2O + CO2 + Mg(NO3)2 |
What does nitric acid magnesium carbonate make?
Balanced chemical equation for Magnesium carbonate + nitric acid =magnesium nitrate +water +carbon dioxide.
What salt is formed when nitric acid reacts with magnesium carbonate?
In this type of reaction an acid reacts with a carbonate to give a salt, water and carbon dioxide. As the reacting alkali is zinc carbonate, the product will be a zinc salt. As the acid used is nitric acid, the salt produced will be a nitrate.
What does magnesium and nitric acid make?
magnesium nitrate
magnesium reacts with nitric acid to form magnesium nitrate and hydrogen gas. You can make magnesium nitrate by mixing nitric acid and magnesium metal.
What type of reaction is calcium carbonate with nitric acid?
It has been postulated that the reaction of nitric acid with calcium carbonate, namely, CaCO3(s)+2HNO3(g)->Ca(NO3)2(s)+CO2(g)+H2O(g), plays an important role in the atmosphere.
What is the word equation for magnesium and nitric acid?
How to Balance: HNO3 + Mg = Mg(NO3)2 + H2| Breslyn.org.
What salts do nitric acid make?
nitric acid produces nitrate salts. sulfuric acid produces sulfate salts.
What happens when nitric acid is added to magnesium?
– When magnesium metal reacts with very dilute nitric acid it gives magnesium nitrate (Mg(NO3)2). Along with magnesium nitrate highly flammable hydrogen gas (H2) is also produced.